C8H14N6O3 — CID 5372680
[(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] N-tert-butylcarbamate (PubChem CID 5372680) has the molecular formula C8H14N6O3 and a molecular weight of 242.24 g/mol. Its IUPAC name is [(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] N-tert-butylcarbamate.
| Compound Name | [(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 5372680 |
| Molecular Formula | C8H14N6O3 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | [(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O/N=C(/N)c1nonc1N |
| InChI | InChI=1S/C8H14N6O3/c1-8(2,3)11-7(15)16-13-5(9)4-6(10)14-17-12-4/h1-3H3,(H2,9,13)(H2,10,14)(H,11,15) |
| InChIKey | DKMMBCUKYVEARP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|