About 3-amino-1,1-diethylthiourea
3-amino-1,1-diethylthiourea (PubChem CID 5372930) has the molecular formula C5H13N3S
and a molecular weight of 147.25 g/mol. Its IUPAC name is 3-amino-1,1-diethylthiourea.
Molecular Properties
| Compound Name | 3-amino-1,1-diethylthiourea |
| PubChem CID | 5372930 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 3-amino-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)NN |
| InChI | InChI=1S/C5H13N3S/c1-3-8(4-2)5(9)7-6/h3-4,6H2,1-2H3,(H,7,9) |
| InChIKey | VHVCXPOTKXZFCZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1,1-diethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,1-diethylthiourea?
The IUPAC name of 3-amino-1,1-diethylthiourea (CID 5372930) is 3-amino-1,1-diethylthiourea.
What is the SMILES notation for 3-amino-1,1-diethylthiourea?
The canonical SMILES for 3-amino-1,1-diethylthiourea is CCN(CC)C(=S)NN.
What is the InChIKey of 3-amino-1,1-diethylthiourea?
The InChIKey is VHVCXPOTKXZFCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3S/c1-3-8(4-2)5(9)7-6/h3-4,6H2,1-2H3,(H,7,9).
What are the key properties of 3-amino-1,1-diethylthiourea?
3-amino-1,1-diethylthiourea has a molecular weight of 147.25 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,1-diethylthiourea is sourced from PubChem (CID 5372930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).