About (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol
(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol (PubChem CID 5372931) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol |
| PubChem CID | 5372931 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol |
| SMILES | CC1=C(/C=C/CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C12H20O/c1-10-6-4-8-12(2,3)11(10)7-5-9-13/h5,7,13H,4,6,8-9H2,1-3H3/b7-5+ |
| InChIKey | GFSKLLUNKJXCDN-FNORWQNLSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol?
The IUPAC name of (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol (CID 5372931) is (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol.
What is the SMILES notation for (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol?
The canonical SMILES for (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol is CC1=C(/C=C/CO)C(C)(C)CCC1.
What is the InChIKey of (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol?
The InChIKey is GFSKLLUNKJXCDN-FNORWQNLSA-N. The full InChI is InChI=1S/C12H20O/c1-10-6-4-8-12(2,3)11(10)7-5-9-13/h5,7,13H,4,6,8-9H2,1-3H3/b7-5+.
What are the key properties of (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol?
(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol has a molecular weight of 180.29 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-ol is sourced from PubChem (CID 5372931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).