C20H25N3O9S — CID 5373051
methyl 3,4,5-triacetyloxy-6-[(2-aminophenyl)carbamothioylamino]oxane-2-carboxylate (PubChem CID 5373051) has the molecular formula C20H25N3O9S and a molecular weight of 483.50 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-[(2-aminophenyl)carbamothioylamino]oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-triacetyloxy-6-[(2-aminophenyl)carbamothioylamino]oxane-2-carboxylate |
|---|---|
| PubChem CID | 5373051 |
| Molecular Formula | C20H25N3O9S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | methyl 3,4,5-triacetyloxy-6-[(2-aminophenyl)carbamothioylamino]oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(NC(=S)Nc2ccccc2N)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H25N3O9S/c1-9(24)29-14-15(30-10(2)25)17(19(27)28-4)32-18(16(14)31-11(3)26)23-20(33)22-13-8-6-5-7-12(13)21/h5-8,14-18H,21H2,1-4H3,(H2,22,23,33) |
| InChIKey | OUWRHTAWHPUIHV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 164.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|