C32H62N2O6 — CID 537315
1-(16-decanoyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl)decan-1-one (PubChem CID 537315) has the molecular formula C32H62N2O6 and a molecular weight of 570.86 g/mol. Its IUPAC name is 1-(16-decanoyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl)decan-1-one.
| Compound Name | 1-(16-decanoyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl)decan-1-one |
|---|---|
| PubChem CID | 537315 |
| Molecular Formula | C32H62N2O6 |
| Molecular Weight | 570.86 g/mol |
| Exact Mass | 570.46 |
| IUPAC Name | 1-(16-decanoyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl)decan-1-one |
| SMILES | CCCCCCCCCC(=O)N1CCOCCOCCN(C(=O)CCCCCCCCC)CCOCCOCC1 |
| InChI | InChI=1S/C32H62N2O6/c1-3-5-7-9-11-13-15-17-31(35)33-19-23-37-27-29-39-25-21-34(22-26-40-30-28-38-24-20-33)32(36)18-16-14-12-10-8-6-4-2/h3-30H2,1-2H3 |
| InChIKey | KCFZFQABZPSNEJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.86 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|