C11H14O3 — CID 5373154
(3Z,6Z)-3,4,6,7-tetramethyl-5H-oxocine-2,8-dione (PubChem CID 5373154) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (3Z,6Z)-3,4,6,7-tetramethyl-5H-oxocine-2,8-dione.
| Compound Name | (3Z,6Z)-3,4,6,7-tetramethyl-5H-oxocine-2,8-dione |
|---|---|
| PubChem CID | 5373154 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (3Z,6Z)-3,4,6,7-tetramethyl-5H-oxocine-2,8-dione |
| SMILES | C/C1=C(\C)C(=O)OC(=O)/C(C)=C(/C)C1 |
| InChI | InChI=1S/C11H14O3/c1-6-5-7(2)9(4)11(13)14-10(12)8(6)3/h5H2,1-4H3/b8-6-,9-7- |
| InChIKey | DHEZSFLTSGDTON-VRHVFUOLSA-N |
| XLogP | 2.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|