About 1-hexoxy-3-methylhexane
1-hexoxy-3-methylhexane (PubChem CID 537316) has the molecular formula C13H28O
and a molecular weight of 200.37 g/mol. Its IUPAC name is 1-hexoxy-3-methylhexane.
Molecular Properties
| Compound Name | 1-hexoxy-3-methylhexane |
| PubChem CID | 537316 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | 1-hexoxy-3-methylhexane |
| SMILES | CCCCCCOCCC(C)CCC |
| InChI | InChI=1S/C13H28O/c1-4-6-7-8-11-14-12-10-13(3)9-5-2/h13H,4-12H2,1-3H3 |
| InChIKey | CSFHERUJZVJARQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexoxy-3-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexoxy-3-methylhexane?
The IUPAC name of 1-hexoxy-3-methylhexane (CID 537316) is 1-hexoxy-3-methylhexane.
What is the SMILES notation for 1-hexoxy-3-methylhexane?
The canonical SMILES for 1-hexoxy-3-methylhexane is CCCCCCOCCC(C)CCC.
What is the InChIKey of 1-hexoxy-3-methylhexane?
The InChIKey is CSFHERUJZVJARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O/c1-4-6-7-8-11-14-12-10-13(3)9-5-2/h13H,4-12H2,1-3H3.
What are the key properties of 1-hexoxy-3-methylhexane?
1-hexoxy-3-methylhexane has a molecular weight of 200.37 g/mol, XLogP of 4.41, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexoxy-3-methylhexane is sourced from PubChem (CID 537316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).