C16H27N — CID 5373327
4-[(3E)-hexa-3,5-dienyl]-1-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 5373327) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 4-[(3E)-hexa-3,5-dienyl]-1-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 4-[(3E)-hexa-3,5-dienyl]-1-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 5373327 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 4-[(3E)-hexa-3,5-dienyl]-1-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | C=C/C=C/CCC1CCC(C)C2CCCCN12 |
| InChI | InChI=1S/C16H27N/c1-3-4-5-6-9-15-12-11-14(2)16-10-7-8-13-17(15)16/h3-5,14-16H,1,6-13H2,2H3/b5-4+ |
| InChIKey | HJWHERJNPDEVKG-SNAWJCMRSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|