C8H15F3N2O — CID 53733314
(2S)-2-amino-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 53733314) has the molecular formula C8H15F3N2O and a molecular weight of 212.21 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 53733314 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC(C)(C)[C@@H](C(=O)NCC(F)(F)F)N |
| InChI | InChI=1S/C8H15F3N2O/c1-7(2,3)5(12)6(14)13-4-8(9,10)11/h5H,4,12H2,1-3H3,(H,13,14)/t5-/m1/s1 |
| InChIKey | CPKFEQXFJKNNID-RXMQYKEDSA-N |
| XLogP | 1.50 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 208 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |