C22H42O6Si — CID 5373594
7-[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]-4-methoxy-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 5373594) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is 7-[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]-4-methoxy-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | 7-[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]-4-methoxy-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 5373594 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 7-[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]-4-methoxy-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | COC1OCC(O)(C/C=C\C(C)C(C)O[Si](C)(C)C(C)(C)C)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C22H42O6Si/c1-15(16(2)28-29(9,10)20(3,4)5)12-11-13-22(23)14-25-19(24-8)17-18(22)27-21(6,7)26-17/h11-12,15-19,23H,13-14H2,1-10H3/b12-11- |
| InChIKey | WKACJYZWRLHACK-QXMHVHEDSA-N |
| XLogP | 4.23 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|