7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid

C10H8N2O3 — CID 5373672

IUPAC7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid
SMILESCc1ccc2c(=O)c(C(=O)O)c[nH]c2n1
InChIInChI=1S/C10H8N2O3/c1-5-2-3-6-8(13)7(10(14)15)4-11-9(6)12-5/h2-4H,1H3,(H,14,15)(H,11,12,13)
InChIKeyWHJTTWIMQIGVJK-UHFFFAOYSA-N
MW204.19 g/mol
LogP0.93
Rot. Bonds1

About 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid

7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid (PubChem CID 5373672) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid
PubChem CID5373672
Molecular FormulaC10H8N2O3
Molecular Weight204.19 g/mol
Exact Mass204.05
IUPAC Name7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid
SMILESCc1ccc2c(=O)c(C(=O)O)c[nH]c2n1
InChIInChI=1S/C10H8N2O3/c1-5-2-3-6-8(13)7(10(14)15)4-11-9(6)12-5/h2-4H,1H3,(H,14,15)(H,11,12,13)
InChIKeyWHJTTWIMQIGVJK-UHFFFAOYSA-N
XLogP0.93
TPSA83.05 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 50.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid?
The IUPAC name of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid (CID 5373672) is 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid?
The canonical SMILES for 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is Cc1ccc2c(=O)c(C(=O)O)c[nH]c2n1.
What is the InChIKey of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid?
The InChIKey is WHJTTWIMQIGVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c1-5-2-3-6-8(13)7(10(14)15)4-11-9(6)12-5/h2-4H,1H3,(H,14,15)(H,11,12,13).
What are the key properties of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid?
7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid has a molecular weight of 204.19 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 5373672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).