About ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate
ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate (PubChem CID 5373695) has the molecular formula C11H12O2S4
and a molecular weight of 304.48 g/mol. Its IUPAC name is ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate |
| PubChem CID | 5373695 |
| Molecular Formula | C11H12O2S4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)S/C(=C2/SC=C(C)S2)S1 |
| InChI | InChI=1S/C11H12O2S4/c1-4-13-9(12)8-7(3)16-11(17-8)10-14-5-6(2)15-10/h5H,4H2,1-3H3/b11-10+ |
| InChIKey | BQYVJTDKZHMYMA-ZHACJKMWSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate?
The IUPAC name of ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate (CID 5373695) is ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate.
What is the SMILES notation for ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate?
The canonical SMILES for ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate is CCOC(=O)C1=C(C)S/C(=C2/SC=C(C)S2)S1.
What is the InChIKey of ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate?
The InChIKey is BQYVJTDKZHMYMA-ZHACJKMWSA-N. The full InChI is InChI=1S/C11H12O2S4/c1-4-13-9(12)8-7(3)16-11(17-8)10-14-5-6(2)15-10/h5H,4H2,1-3H3/b11-10+.
What are the key properties of ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate?
ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate has a molecular weight of 304.48 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-5-methyl-2-(4-methyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carboxylate is sourced from PubChem (CID 5373695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).