About (Z)-1-phenyl-N-trimethylsilylmethanimine
(Z)-1-phenyl-N-trimethylsilylmethanimine (PubChem CID 5373796) has the molecular formula C10H15NSi
and a molecular weight of 177.32 g/mol. Its IUPAC name is (Z)-1-phenyl-N-trimethylsilylmethanimine.
Molecular Properties
| Compound Name | (Z)-1-phenyl-N-trimethylsilylmethanimine |
| PubChem CID | 5373796 |
| Molecular Formula | C10H15NSi |
| Molecular Weight | 177.32 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (Z)-1-phenyl-N-trimethylsilylmethanimine |
| SMILES | C[Si](C)(C)/N=C\c1ccccc1 |
| InChI | InChI=1S/C10H15NSi/c1-12(2,3)11-9-10-7-5-4-6-8-10/h4-9H,1-3H3/b11-9- |
| InChIKey | ATGAAABKKYCMRZ-LUAWRHEFSA-N |
| XLogP | 2.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-phenyl-N-trimethylsilylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-phenyl-N-trimethylsilylmethanimine?
The IUPAC name of (Z)-1-phenyl-N-trimethylsilylmethanimine (CID 5373796) is (Z)-1-phenyl-N-trimethylsilylmethanimine.
What is the SMILES notation for (Z)-1-phenyl-N-trimethylsilylmethanimine?
The canonical SMILES for (Z)-1-phenyl-N-trimethylsilylmethanimine is C[Si](C)(C)/N=C\c1ccccc1.
What is the InChIKey of (Z)-1-phenyl-N-trimethylsilylmethanimine?
The InChIKey is ATGAAABKKYCMRZ-LUAWRHEFSA-N. The full InChI is InChI=1S/C10H15NSi/c1-12(2,3)11-9-10-7-5-4-6-8-10/h4-9H,1-3H3/b11-9-.
What are the key properties of (Z)-1-phenyl-N-trimethylsilylmethanimine?
(Z)-1-phenyl-N-trimethylsilylmethanimine has a molecular weight of 177.32 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-phenyl-N-trimethylsilylmethanimine is sourced from PubChem (CID 5373796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).