About 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one
3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one (PubChem CID 5373801) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one |
| PubChem CID | 5373801 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one |
| SMILES | C=C/C=C\CC1=C(C)CCC1=O |
| InChI | InChI=1S/C11H14O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h3-5H,1,6-8H2,2H3/b5-4- |
| InChIKey | GBEJULSURQZDNX-PLNGDYQASA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one?
The IUPAC name of 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one (CID 5373801) is 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one.
What is the SMILES notation for 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one?
The canonical SMILES for 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one is C=C/C=C\CC1=C(C)CCC1=O.
What is the InChIKey of 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one?
The InChIKey is GBEJULSURQZDNX-PLNGDYQASA-N. The full InChI is InChI=1S/C11H14O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h3-5H,1,6-8H2,2H3/b5-4-.
What are the key properties of 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one?
3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one has a molecular weight of 162.23 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[(2Z)-penta-2,4-dienyl]cyclopent-2-en-1-one is sourced from PubChem (CID 5373801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).