About (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine
(5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine (PubChem CID 5373887) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine |
| PubChem CID | 5373887 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine |
| SMILES | C1=NCCC/C1=C1/CCCCN1 |
| InChI | InChI=1S/C10H16N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h8,12H,1-7H2/b10-9+ |
| InChIKey | LLIBMCDDSXSYAK-MDZDMXLPSA-N |
| XLogP | 1.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine?
The IUPAC name of (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine (CID 5373887) is (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine.
What is the SMILES notation for (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine?
The canonical SMILES for (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine is C1=NCCC/C1=C1/CCCCN1.
What is the InChIKey of (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine?
The InChIKey is LLIBMCDDSXSYAK-MDZDMXLPSA-N. The full InChI is InChI=1S/C10H16N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h8,12H,1-7H2/b10-9+.
What are the key properties of (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine?
(5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine has a molecular weight of 164.25 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-piperidin-2-ylidene-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 5373887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).