C11H10ClN5O4 — CID 5374202
4-amino-N'-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 5374202) has the molecular formula C11H10ClN5O4 and a molecular weight of 311.69 g/mol. Its IUPAC name is 4-amino-N'-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 5374202 |
| Molecular Formula | C11H10ClN5O4 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 4-amino-N'-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N/OCc1cc2c(cc1Cl)OCO2)c1nonc1N |
| InChI | InChI=1S/C11H10ClN5O4/c12-6-2-8-7(18-4-19-8)1-5(6)3-20-16-10(13)9-11(14)17-21-15-9/h1-2H,3-4H2,(H2,13,16)(H2,14,17) |
| InChIKey | UKZSNQMKWWOQSJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|