C13H24O4Si2 — CID 5374893
trimethylsilyl (2Z,4Z)-6-oxo-4-trimethylsilyloxyhepta-2,4-dienoate (PubChem CID 5374893) has the molecular formula C13H24O4Si2 and a molecular weight of 300.50 g/mol. Its IUPAC name is trimethylsilyl (2Z,4Z)-6-oxo-4-trimethylsilyloxyhepta-2,4-dienoate.
| Compound Name | trimethylsilyl (2Z,4Z)-6-oxo-4-trimethylsilyloxyhepta-2,4-dienoate |
|---|---|
| PubChem CID | 5374893 |
| Molecular Formula | C13H24O4Si2 |
| Molecular Weight | 300.50 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | trimethylsilyl (2Z,4Z)-6-oxo-4-trimethylsilyloxyhepta-2,4-dienoate |
| SMILES | CC(=O)/C=C(/C=C\C(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H24O4Si2/c1-11(14)10-12(16-18(2,3)4)8-9-13(15)17-19(5,6)7/h8-10H,1-7H3/b9-8-,12-10- |
| InChIKey | SKNFFQFMAUKFJK-DMGFJBLZSA-N |
| XLogP | 3.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|