C5H6N4S2 — CID 5375015
6-ethyl-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-thione (PubChem CID 5375015) has the molecular formula C5H6N4S2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 6-ethyl-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-thione.
| Compound Name | 6-ethyl-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-thione |
|---|---|
| PubChem CID | 5375015 |
| Molecular Formula | C5H6N4S2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 6-ethyl-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-thione |
| SMILES | CCc1nn2c(=S)[nH]nc2s1 |
| InChI | InChI=1S/C5H6N4S2/c1-2-3-8-9-4(10)6-7-5(9)11-3/h2H2,1H3,(H,6,10) |
| InChIKey | KDVQZQVLKBMXNA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|