About 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide (PubChem CID 5375067) has the molecular formula C7H11BrN4O
and a molecular weight of 247.10 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide |
| PubChem CID | 5375067 |
| Molecular Formula | C7H11BrN4O |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide |
| SMILES | Cc1nn(C/C(N)=N\O)c(C)c1Br |
| InChI | InChI=1S/C7H11BrN4O/c1-4-7(8)5(2)12(10-4)3-6(9)11-13/h13H,3H2,1-2H3,(H2,9,11) |
| InChIKey | SUMHLVREPKLBKM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide?
The IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide (CID 5375067) is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide?
The canonical SMILES for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide is Cc1nn(C/C(N)=N\O)c(C)c1Br.
What is the InChIKey of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide?
The InChIKey is SUMHLVREPKLBKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrN4O/c1-4-7(8)5(2)12(10-4)3-6(9)11-13/h13H,3H2,1-2H3,(H2,9,11).
What are the key properties of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide?
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide has a molecular weight of 247.10 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N'-hydroxyethanimidamide is sourced from PubChem (CID 5375067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).