About (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one
(3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one (PubChem CID 5375071) has the molecular formula C23H18N2O2
and a molecular weight of 354.41 g/mol. Its IUPAC name is (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one.
Molecular Properties
| Compound Name | (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one |
| PubChem CID | 5375071 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one |
| SMILES | N/N=C1\c2ccccc2C(=O)C1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O2/c24-25-21-17-13-7-8-14-18(17)22(26)20(21)23(27)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19-20H,24H2/b25-21+ |
| InChIKey | QBGMRRUHCFHZLC-NJNXFGOHSA-N |
| XLogP | 3.56 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one?
The IUPAC name of (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one (CID 5375071) is (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one.
What is the SMILES notation for (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one?
The canonical SMILES for (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one is N/N=C1\c2ccccc2C(=O)C1C(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one?
The InChIKey is QBGMRRUHCFHZLC-NJNXFGOHSA-N. The full InChI is InChI=1S/C23H18N2O2/c24-25-21-17-13-7-8-14-18(17)22(26)20(21)23(27)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19-20H,24H2/b25-21+.
What are the key properties of (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one?
(3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one has a molecular weight of 354.41 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one is sourced from PubChem (CID 5375071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).