About ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate
ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate (PubChem CID 5375149) has the molecular formula C17H20F3NO4
and a molecular weight of 359.34 g/mol. Its IUPAC name is ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate |
| PubChem CID | 5375149 |
| Molecular Formula | C17H20F3NO4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(C)NC(=O)C(OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H20F3NO4/c1-4-25-14(22)11-10-12(2)21-15(23)16(24-3,17(18,19)20)13-8-6-5-7-9-13/h5-12H,4H2,1-3H3,(H,21,23)/b11-10+ |
| InChIKey | DBRCYEOXBDTMJJ-ZHACJKMWSA-N |
| XLogP | 2.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate?
The IUPAC name of ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate (CID 5375149) is ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate.
What is the SMILES notation for ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate?
The canonical SMILES for ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate is CCOC(=O)/C=C/C(C)NC(=O)C(OC)(c1ccccc1)C(F)(F)F.
What is the InChIKey of ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate?
The InChIKey is DBRCYEOXBDTMJJ-ZHACJKMWSA-N. The full InChI is InChI=1S/C17H20F3NO4/c1-4-25-14(22)11-10-12(2)21-15(23)16(24-3,17(18,19)20)13-8-6-5-7-9-13/h5-12H,4H2,1-3H3,(H,21,23)/b11-10+.
What are the key properties of ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate?
ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate has a molecular weight of 359.34 g/mol, XLogP of 2.71, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate is sourced from PubChem (CID 5375149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).