C6H6N6O3 — CID 537534
2-amino-5-methyl-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 537534) has the molecular formula C6H6N6O3 and a molecular weight of 210.15 g/mol. Its IUPAC name is 2-amino-5-methyl-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-amino-5-methyl-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 537534 |
| Molecular Formula | C6H6N6O3 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-amino-5-methyl-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1nc2nc(N)[nH]n2c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N6O3/c1-2-3(12(14)15)4(13)11-6(8-2)9-5(7)10-11/h1H3,(H3,7,8,9,10) |
| InChIKey | KUHCVQVCJRLMAO-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|