About 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione
5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 5375371) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 5375371 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | C/C=C(\C)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H14N2O2/c1-5-7(2)8-6-11(3)10(14)12(4)9(8)13/h5-6H,1-4H3/b7-5+ |
| InChIKey | JYXLUQAVHOESKL-FNORWQNLSA-N |
| XLogP | 0.51 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione (CID 5375371) is 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione is C/C=C(\C)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is JYXLUQAVHOESKL-FNORWQNLSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-5-7(2)8-6-11(3)10(14)12(4)9(8)13/h5-6H,1-4H3/b7-5+.
What are the key properties of 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione?
5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 194.23 g/mol, XLogP of 0.51, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-but-2-en-2-yl]-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 5375371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).