About 4-methylpentane-2-thiol
4-methylpentane-2-thiol (PubChem CID 537594) has the molecular formula C6H14S
and a molecular weight of 118.24 g/mol. Its IUPAC name is 4-methylpentane-2-thiol.
Molecular Properties
| Compound Name | 4-methylpentane-2-thiol |
| PubChem CID | 537594 |
| Molecular Formula | C6H14S |
| Molecular Weight | 118.24 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 4-methylpentane-2-thiol |
| SMILES | CC(C)CC(C)S |
| InChI | InChI=1S/C6H14S/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3 |
| InChIKey | JBCIMWBQDMBMMP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentane-2-thiol?
The IUPAC name of 4-methylpentane-2-thiol (CID 537594) is 4-methylpentane-2-thiol.
What is the SMILES notation for 4-methylpentane-2-thiol?
The canonical SMILES for 4-methylpentane-2-thiol is CC(C)CC(C)S.
What is the InChIKey of 4-methylpentane-2-thiol?
The InChIKey is JBCIMWBQDMBMMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3.
What are the key properties of 4-methylpentane-2-thiol?
4-methylpentane-2-thiol has a molecular weight of 118.24 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentane-2-thiol is sourced from PubChem (CID 537594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).