About (Z)-1,2-dibromohex-1-en-3-ol
(Z)-1,2-dibromohex-1-en-3-ol (PubChem CID 5376108) has the molecular formula C6H10Br2O
and a molecular weight of 257.95 g/mol. Its IUPAC name is (Z)-1,2-dibromohex-1-en-3-ol.
Molecular Properties
| Compound Name | (Z)-1,2-dibromohex-1-en-3-ol |
| PubChem CID | 5376108 |
| Molecular Formula | C6H10Br2O |
| Molecular Weight | 257.95 g/mol |
| Exact Mass | 255.91 |
| IUPAC Name | (Z)-1,2-dibromohex-1-en-3-ol |
| SMILES | CCCC(O)/C(Br)=C/Br |
| InChI | InChI=1S/C6H10Br2O/c1-2-3-6(9)5(8)4-7/h4,6,9H,2-3H2,1H3/b5-4- |
| InChIKey | AHKXIIONADKWCU-PLNGDYQASA-N |
| XLogP | 2.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.95 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-1,2-dibromohex-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,2-dibromohex-1-en-3-ol?
The IUPAC name of (Z)-1,2-dibromohex-1-en-3-ol (CID 5376108) is (Z)-1,2-dibromohex-1-en-3-ol.
What is the SMILES notation for (Z)-1,2-dibromohex-1-en-3-ol?
The canonical SMILES for (Z)-1,2-dibromohex-1-en-3-ol is CCCC(O)/C(Br)=C/Br.
What is the InChIKey of (Z)-1,2-dibromohex-1-en-3-ol?
The InChIKey is AHKXIIONADKWCU-PLNGDYQASA-N. The full InChI is InChI=1S/C6H10Br2O/c1-2-3-6(9)5(8)4-7/h4,6,9H,2-3H2,1H3/b5-4-.
What are the key properties of (Z)-1,2-dibromohex-1-en-3-ol?
(Z)-1,2-dibromohex-1-en-3-ol has a molecular weight of 257.95 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,2-dibromohex-1-en-3-ol is sourced from PubChem (CID 5376108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).