C30H52N2 — CID 5376258
(6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene-12,13-diamine (PubChem CID 5376258) has the molecular formula C30H52N2 and a molecular weight of 440.76 g/mol. Its IUPAC name is (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene-12,13-diamine.
| Compound Name | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene-12,13-diamine |
|---|---|
| PubChem CID | 5376258 |
| Molecular Formula | C30H52N2 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.41 |
| IUPAC Name | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene-12,13-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(N)C(N)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H52N2/c1-23(2)13-9-15-25(5)17-11-19-27(7)21-29(31)30(32)22-28(8)20-12-18-26(6)16-10-14-24(3)4/h13-14,17-18,21-22,29-30H,9-12,15-16,19-20,31-32H2,1-8H3/b25-17+,26-18+,27-21+,28-22+ |
| InChIKey | GVFQVRGAAZEISR-ZXPULGRGSA-N |
| XLogP | 8.48 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|