C23H32O8 — CID 5376389
methyl (2E,4E)-6-[6-acetyloxy-8-(acetyloxymethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate (PubChem CID 5376389) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is methyl (2E,4E)-6-[6-acetyloxy-8-(acetyloxymethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-6-[6-acetyloxy-8-(acetyloxymethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 5376389 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | methyl (2E,4E)-6-[6-acetyloxy-8-(acetyloxymethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-4-methylhepta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C(C)=C/C(C)C1OC2(C)OC(C(OC(C)=O)C=C2COC(C)=O)C1C |
| InChI | InChI=1S/C23H32O8/c1-13(8-9-20(26)27-7)10-14(2)21-15(3)22-19(29-17(5)25)11-18(12-28-16(4)24)23(6,30-21)31-22/h8-11,14-15,19,21-22H,12H2,1-7H3/b9-8+,13-10+ |
| InChIKey | XKMKRMNPBPKGFG-PEGOPYGQSA-N |
| XLogP | 2.87 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|