C26H40O8 — CID 5376403
(3E,5E,11E,13E)-8,16-bis[1-(methoxymethoxy)propan-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione (PubChem CID 5376403) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is (3E,5E,11E,13E)-8,16-bis[1-(methoxymethoxy)propan-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione.
| Compound Name | (3E,5E,11E,13E)-8,16-bis[1-(methoxymethoxy)propan-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
|---|---|
| PubChem CID | 5376403 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (3E,5E,11E,13E)-8,16-bis[1-(methoxymethoxy)propan-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
| SMILES | COCOCC(C)C1OC(=O)/C=C/C=C/C(C)C(C(C)COCOC)OC(=O)/C=C/C=C/C1C |
| InChI | InChI=1S/C26H40O8/c1-19-11-7-9-13-24(28)34-26(22(4)16-32-18-30-6)20(2)12-8-10-14-23(27)33-25(19)21(3)15-31-17-29-5/h7-14,19-22,25-26H,15-18H2,1-6H3/b11-7+,12-8+,13-9+,14-10+ |
| InChIKey | FCOMLOQOWDUYKR-DQVHGGFXSA-N |
| XLogP | 3.83 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|