C27H50O5Si2 — CID 5376479
methyl 5-[5-trimethylsilyloxy-4-[(E)-3-trimethylsilyloxyoct-1-enyl]-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan-2-yl]pentanoate (PubChem CID 5376479) has the molecular formula C27H50O5Si2 and a molecular weight of 510.86 g/mol. Its IUPAC name is methyl 5-[5-trimethylsilyloxy-4-[(E)-3-trimethylsilyloxyoct-1-enyl]-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan-2-yl]pentanoate.
| Compound Name | methyl 5-[5-trimethylsilyloxy-4-[(E)-3-trimethylsilyloxyoct-1-enyl]-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan-2-yl]pentanoate |
|---|---|
| PubChem CID | 5376479 |
| Molecular Formula | C27H50O5Si2 |
| Molecular Weight | 510.86 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | methyl 5-[5-trimethylsilyloxy-4-[(E)-3-trimethylsilyloxyoct-1-enyl]-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan-2-yl]pentanoate |
| SMILES | CCCCCC(/C=C/C1C2=CC(CCCCC(=O)OC)OC2CC1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C27H50O5Si2/c1-9-10-11-14-21(31-33(3,4)5)17-18-23-24-19-22(15-12-13-16-27(28)29-2)30-25(24)20-26(23)32-34(6,7)8/h17-19,21-23,25-26H,9-16,20H2,1-8H3/b18-17+ |
| InChIKey | DMIVKSHQLZXCSW-ISLYRVAYSA-N |
| XLogP | 7.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.86 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|