About 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione
4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione (PubChem CID 5376502) has the molecular formula C16H14N2S2
and a molecular weight of 298.44 g/mol. Its IUPAC name is 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione |
| PubChem CID | 5376502 |
| Molecular Formula | C16H14N2S2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione |
| SMILES | CSC1=NC(=S)NC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2S2/c1-20-14-16(18-15(19)17-14,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H,18,19) |
| InChIKey | KKMRFVZTTDNGEJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione?
The IUPAC name of 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione (CID 5376502) is 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione.
What is the SMILES notation for 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione?
The canonical SMILES for 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione is CSC1=NC(=S)NC1(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione?
The InChIKey is KKMRFVZTTDNGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2S2/c1-20-14-16(18-15(19)17-14,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H,18,19).
What are the key properties of 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione?
4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione has a molecular weight of 298.44 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-5,5-diphenyl-1H-imidazole-2-thione is sourced from PubChem (CID 5376502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).