C28H40O2 — CID 5376563
3-[(E)-5,6-dimethylhept-3-en-2-yl]-11b-hydroxy-3a,6-dimethyl-2,3,4,5,7,8,9,10-octahydrocyclopenta[a]anthracen-1-one (PubChem CID 5376563) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 3-[(E)-5,6-dimethylhept-3-en-2-yl]-11b-hydroxy-3a,6-dimethyl-2,3,4,5,7,8,9,10-octahydrocyclopenta[a]anthracen-1-one.
| Compound Name | 3-[(E)-5,6-dimethylhept-3-en-2-yl]-11b-hydroxy-3a,6-dimethyl-2,3,4,5,7,8,9,10-octahydrocyclopenta[a]anthracen-1-one |
|---|---|
| PubChem CID | 5376563 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 3-[(E)-5,6-dimethylhept-3-en-2-yl]-11b-hydroxy-3a,6-dimethyl-2,3,4,5,7,8,9,10-octahydrocyclopenta[a]anthracen-1-one |
| SMILES | Cc1c2c(cc3c1CCC1(C)C(C(C)/C=C/C(C)C(C)C)CC(=O)C31O)CCCC2 |
| InChI | InChI=1S/C28H40O2/c1-17(2)18(3)11-12-19(4)24-16-26(29)28(30)25-15-21-9-7-8-10-22(21)20(5)23(25)13-14-27(24,28)6/h11-12,15,17-19,24,30H,7-10,13-14,16H2,1-6H3/b12-11+ |
| InChIKey | FRJKTKNFEGQQRJ-VAWYXSNFSA-N |
| XLogP | 6.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|