About (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene
(3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene (PubChem CID 5376740) has the molecular formula C18H16
and a molecular weight of 232.33 g/mol. Its IUPAC name is (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene.
Molecular Properties
| Compound Name | (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene |
| PubChem CID | 5376740 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene |
| SMILES | c1ccc2c(c1)CC/C2=C1/CCc2ccccc21 |
| InChI | InChI=1S/C18H16/c1-3-7-15-13(5-1)9-11-17(15)18-12-10-14-6-2-4-8-16(14)18/h1-8H,9-12H2/b18-17+ |
| InChIKey | HLSBTOHZBUYMFU-ISLYRVAYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene?
The IUPAC name of (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene (CID 5376740) is (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene.
What is the SMILES notation for (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene?
The canonical SMILES for (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene is c1ccc2c(c1)CC/C2=C1/CCc2ccccc21.
What is the InChIKey of (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene?
The InChIKey is HLSBTOHZBUYMFU-ISLYRVAYSA-N. The full InChI is InChI=1S/C18H16/c1-3-7-15-13(5-1)9-11-17(15)18-12-10-14-6-2-4-8-16(14)18/h1-8H,9-12H2/b18-17+.
What are the key properties of (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene?
(3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene has a molecular weight of 232.33 g/mol, XLogP of 4.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene is sourced from PubChem (CID 5376740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).