About 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene
1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene (PubChem CID 5376805) has the molecular formula C18H18
and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene.
Molecular Properties
| Compound Name | 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene |
| PubChem CID | 5376805 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene |
| SMILES | Cc1ccc(/C=C/C=C/c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H18/c1-15-7-11-17(12-8-15)5-3-4-6-18-13-9-16(2)10-14-18/h3-14H,1-2H3/b5-3+,6-4+ |
| InChIKey | KGLYHHCCIBZMLN-GGWOSOGESA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene?
The IUPAC name of 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene (CID 5376805) is 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene.
What is the SMILES notation for 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene?
The canonical SMILES for 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene is Cc1ccc(/C=C/C=C/c2ccc(C)cc2)cc1.
What is the InChIKey of 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene?
The InChIKey is KGLYHHCCIBZMLN-GGWOSOGESA-N. The full InChI is InChI=1S/C18H18/c1-15-7-11-17(12-8-15)5-3-4-6-18-13-9-16(2)10-14-18/h3-14H,1-2H3/b5-3+,6-4+.
What are the key properties of 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene?
1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene has a molecular weight of 234.34 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]benzene is sourced from PubChem (CID 5376805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).