About S-methyl 2-methylpropanethioate
S-methyl 2-methylpropanethioate (PubChem CID 537722) has the molecular formula C5H10OS
and a molecular weight of 118.20 g/mol. Its IUPAC name is S-methyl 2-methylpropanethioate.
Molecular Properties
| Compound Name | S-methyl 2-methylpropanethioate |
| PubChem CID | 537722 |
| Molecular Formula | C5H10OS |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | S-methyl 2-methylpropanethioate |
| SMILES | CSC(=O)C(C)C |
| InChI | InChI=1S/C5H10OS/c1-4(2)5(6)7-3/h4H,1-3H3 |
| InChIKey | JODNYDRGCYHKRC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 2-methylpropanethioate?
The IUPAC name of S-methyl 2-methylpropanethioate (CID 537722) is S-methyl 2-methylpropanethioate.
What is the SMILES notation for S-methyl 2-methylpropanethioate?
The canonical SMILES for S-methyl 2-methylpropanethioate is CSC(=O)C(C)C.
What is the InChIKey of S-methyl 2-methylpropanethioate?
The InChIKey is JODNYDRGCYHKRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS/c1-4(2)5(6)7-3/h4H,1-3H3.
What are the key properties of S-methyl 2-methylpropanethioate?
S-methyl 2-methylpropanethioate has a molecular weight of 118.20 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 2-methylpropanethioate is sourced from PubChem (CID 537722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).