About S-(3-oxobutan-2-yl) butanethioate
S-(3-oxobutan-2-yl) butanethioate (PubChem CID 537741) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is S-(3-oxobutan-2-yl) butanethioate.
Molecular Properties
| Compound Name | S-(3-oxobutan-2-yl) butanethioate |
| PubChem CID | 537741 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | S-(3-oxobutan-2-yl) butanethioate |
| SMILES | CCCC(=O)SC(C)C(C)=O |
| InChI | InChI=1S/C8H14O2S/c1-4-5-8(10)11-7(3)6(2)9/h7H,4-5H2,1-3H3 |
| InChIKey | CDRFJPFRTFLHRR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-oxobutan-2-yl) butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-oxobutan-2-yl) butanethioate?
The IUPAC name of S-(3-oxobutan-2-yl) butanethioate (CID 537741) is S-(3-oxobutan-2-yl) butanethioate.
What is the SMILES notation for S-(3-oxobutan-2-yl) butanethioate?
The canonical SMILES for S-(3-oxobutan-2-yl) butanethioate is CCCC(=O)SC(C)C(C)=O.
What is the InChIKey of S-(3-oxobutan-2-yl) butanethioate?
The InChIKey is CDRFJPFRTFLHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S/c1-4-5-8(10)11-7(3)6(2)9/h7H,4-5H2,1-3H3.
What are the key properties of S-(3-oxobutan-2-yl) butanethioate?
S-(3-oxobutan-2-yl) butanethioate has a molecular weight of 174.26 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-oxobutan-2-yl) butanethioate is sourced from PubChem (CID 537741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).