About 3-sulfanylhexyl butanoate
3-sulfanylhexyl butanoate (PubChem CID 537754) has the molecular formula C10H20O2S
and a molecular weight of 204.33 g/mol. Its IUPAC name is 3-sulfanylhexyl butanoate.
Molecular Properties
| Compound Name | 3-sulfanylhexyl butanoate |
| PubChem CID | 537754 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3-sulfanylhexyl butanoate |
| SMILES | CCCC(=O)OCCC(S)CCC |
| InChI | InChI=1S/C10H20O2S/c1-3-5-9(13)7-8-12-10(11)6-4-2/h9,13H,3-8H2,1-2H3 |
| InChIKey | TZNJKOLXWHXDAF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylhexyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylhexyl butanoate?
The IUPAC name of 3-sulfanylhexyl butanoate (CID 537754) is 3-sulfanylhexyl butanoate.
What is the SMILES notation for 3-sulfanylhexyl butanoate?
The canonical SMILES for 3-sulfanylhexyl butanoate is CCCC(=O)OCCC(S)CCC.
What is the InChIKey of 3-sulfanylhexyl butanoate?
The InChIKey is TZNJKOLXWHXDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S/c1-3-5-9(13)7-8-12-10(11)6-4-2/h9,13H,3-8H2,1-2H3.
What are the key properties of 3-sulfanylhexyl butanoate?
3-sulfanylhexyl butanoate has a molecular weight of 204.33 g/mol, XLogP of 2.82, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylhexyl butanoate is sourced from PubChem (CID 537754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).