C21H22N2O2S — CID 53775683
Ethyl 2-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate (PubChem CID 53775683) has the molecular formula C21H22N2O2S and a molecular weight of 366.50 g/mol. Its IUPAC name is ethyl 2-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate.
| Compound Name | Ethyl 2-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
|---|---|
| PubChem CID | 53775683 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl 2-[5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1=CN=C(C=N1)C#CC2=CC3=C(C=C2)SCCC3(C)C |
| InChI | InChI=1S/C21H22N2O2S/c1-4-25-20(24)12-17-14-22-16(13-23-17)7-5-15-6-8-19-18(11-15)21(2,3)9-10-26-19/h6,8,11,13-14H,4,9-10,12H2,1-3H3 |
| InChIKey | DRSWLIGPGISLJM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 77.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 565 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|