C28H22 — CID 5377766
[(1E,3E)-1,3,4-triphenylbuta-1,3-dien-2-yl]benzene (PubChem CID 5377766) has the molecular formula C28H22 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1E,3E)-1,3,4-triphenylbuta-1,3-dien-2-yl]benzene.
| Compound Name | [(1E,3E)-1,3,4-triphenylbuta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 5377766 |
| Molecular Formula | C28H22 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [(1E,3E)-1,3,4-triphenylbuta-1,3-dien-2-yl]benzene |
| SMILES | C(=C(C(=C/c1ccccc1)/c1ccccc1)\c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C28H22/c1-5-13-23(14-6-1)21-27(25-17-9-3-10-18-25)28(26-19-11-4-12-20-26)22-24-15-7-2-8-16-24/h1-22H/b27-21+,28-22+ |
| InChIKey | DAABVBOFAIYKNX-GPAWKIAZSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|