About 4-pentoxybenzene-1,2-dicarbonitrile
4-pentoxybenzene-1,2-dicarbonitrile (PubChem CID 537786) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-pentoxybenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-pentoxybenzene-1,2-dicarbonitrile |
| PubChem CID | 537786 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4-pentoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCCOc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C13H14N2O/c1-2-3-4-7-16-13-6-5-11(9-14)12(8-13)10-15/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | LEYRHJFOAFEIDH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentoxybenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentoxybenzene-1,2-dicarbonitrile?
The IUPAC name of 4-pentoxybenzene-1,2-dicarbonitrile (CID 537786) is 4-pentoxybenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-pentoxybenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-pentoxybenzene-1,2-dicarbonitrile is CCCCCOc1ccc(C#N)c(C#N)c1.
What is the InChIKey of 4-pentoxybenzene-1,2-dicarbonitrile?
The InChIKey is LEYRHJFOAFEIDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O/c1-2-3-4-7-16-13-6-5-11(9-14)12(8-13)10-15/h5-6,8H,2-4,7H2,1H3.
What are the key properties of 4-pentoxybenzene-1,2-dicarbonitrile?
4-pentoxybenzene-1,2-dicarbonitrile has a molecular weight of 214.27 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentoxybenzene-1,2-dicarbonitrile is sourced from PubChem (CID 537786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).