About (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine
(2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine (PubChem CID 5378015) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine |
| PubChem CID | 5378015 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine |
| SMILES | C/C=C1\N(C)C(C)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23N/c1-4-19-20(15-16(2)21(19)3,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h4-14,16H,15H2,1-3H3/b19-4- |
| InChIKey | AJRJPORIQGYFMT-PVOVUMCXSA-N |
| XLogP | 4.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine?
The IUPAC name of (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine (CID 5378015) is (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine.
What is the SMILES notation for (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine?
The canonical SMILES for (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine is C/C=C1\N(C)C(C)CC1(c1ccccc1)c1ccccc1.
What is the InChIKey of (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine?
The InChIKey is AJRJPORIQGYFMT-PVOVUMCXSA-N. The full InChI is InChI=1S/C20H23N/c1-4-19-20(15-16(2)21(19)3,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h4-14,16H,15H2,1-3H3/b19-4-.
What are the key properties of (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine?
(2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine has a molecular weight of 277.41 g/mol, XLogP of 4.60, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine is sourced from PubChem (CID 5378015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).