C9H16O2 — CID 5378288
(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one (PubChem CID 5378288) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one.
| Compound Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one |
|---|---|
| PubChem CID | 5378288 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C |
| InChI | InChI=1S/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h5-7,10H,1-4H3/b8-5- |
| InChIKey | JIYKPNNTWHWONK-YVMONPNESA-N |
| XLogP | 2.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|