About (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one
(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one (PubChem CID 5378584) has the molecular formula C17H12Cl2O
and a molecular weight of 303.19 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one.
Molecular Properties
| Compound Name | (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one |
| PubChem CID | 5378584 |
| Molecular Formula | C17H12Cl2O |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12Cl2O/c18-15-7-1-13(2-8-15)5-11-17(20)12-6-14-3-9-16(19)10-4-14/h1-12H/b11-5+,12-6+ |
| InChIKey | KKVCZNHIJHTDFP-YDWXAUTNSA-N |
| XLogP | 5.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one?
The IUPAC name of (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one (CID 5378584) is (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one.
What is the SMILES notation for (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one?
The canonical SMILES for (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one is O=C(/C=C/c1ccc(Cl)cc1)/C=C/c1ccc(Cl)cc1.
What is the InChIKey of (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one?
The InChIKey is KKVCZNHIJHTDFP-YDWXAUTNSA-N. The full InChI is InChI=1S/C17H12Cl2O/c18-15-7-1-13(2-8-15)5-11-17(20)12-6-14-3-9-16(19)10-4-14/h1-12H/b11-5+,12-6+.
What are the key properties of (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one?
(1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one has a molecular weight of 303.19 g/mol, XLogP of 5.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,4E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one is sourced from PubChem (CID 5378584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).