About bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper
bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper (PubChem CID 5378623) has the molecular formula C22H30CuN2O2S4
and a molecular weight of 546.31 g/mol. Its IUPAC name is bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper.
Molecular Properties
| Compound Name | bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper |
| PubChem CID | 5378623 |
| Molecular Formula | C22H30CuN2O2S4 |
| Molecular Weight | 546.31 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper |
| SMILES | CSC(CN/C=C1/C=CC=CC1=O)SC.CSC(CN/C=C1/C=CC=CC1=O)SC.[Cu] |
| InChI | InChI=1S/2C11H15NOS2.Cu/c2*1-14-11(15-2)8-12-7-9-5-3-4-6-10(9)13;/h2*3-7,11-12H,8H2,1-2H3;/b2*9-7-; |
| InChIKey | KCKMLISIZAGYSV-LHSHWCRNSA-N |
| XLogP | 4.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper?
The IUPAC name of bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper (CID 5378623) is bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper.
What is the SMILES notation for bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper?
The canonical SMILES for bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper is CSC(CN/C=C1/C=CC=CC1=O)SC.CSC(CN/C=C1/C=CC=CC1=O)SC.[Cu].
What is the InChIKey of bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper?
The InChIKey is KCKMLISIZAGYSV-LHSHWCRNSA-N. The full InChI is InChI=1S/2C11H15NOS2.Cu/c2*1-14-11(15-2)8-12-7-9-5-3-4-6-10(9)13;/h2*3-7,11-12H,8H2,1-2H3;/b2*9-7-;.
What are the key properties of bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper?
bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper has a molecular weight of 546.31 g/mol, XLogP of 4.41, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((6Z)-6-[[2,2-bis(methylsulfanyl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper is sourced from PubChem (CID 5378623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).