C16H17N5O2 — CID 5378751
8-[(E)-2-(3-aminophenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 5378751) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 8-[(E)-2-(3-aminophenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[(E)-2-(3-aminophenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 5378751 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 8-[(E)-2-(3-aminophenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(/C=C/c3cccc(N)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H17N5O2/c1-19-12(8-7-10-5-4-6-11(17)9-10)18-14-13(19)15(22)21(3)16(23)20(14)2/h4-9H,17H2,1-3H3/b8-7+ |
| InChIKey | ZEWLAZAHXZVMMY-BQYQJAHWSA-N |
| XLogP | 0.72 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|