C18H27NO11 — CID 537887
[2,3,4,5-tetraacetyloxy-6-(dimethylamino)-6-oxohexyl] acetate (PubChem CID 537887) has the molecular formula C18H27NO11 and a molecular weight of 433.41 g/mol. Its IUPAC name is [2,3,4,5-tetraacetyloxy-6-(dimethylamino)-6-oxohexyl] acetate.
| Compound Name | [2,3,4,5-tetraacetyloxy-6-(dimethylamino)-6-oxohexyl] acetate |
|---|---|
| PubChem CID | 537887 |
| Molecular Formula | C18H27NO11 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | [2,3,4,5-tetraacetyloxy-6-(dimethylamino)-6-oxohexyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)N(C)C |
| InChI | InChI=1S/C18H27NO11/c1-9(20)26-8-14(27-10(2)21)15(28-11(3)22)16(29-12(4)23)17(30-13(5)24)18(25)19(6)7/h14-17H,8H2,1-7H3 |
| InChIKey | VLDSAVXAHRTWCD-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|