About 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole
2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole (PubChem CID 5379000) has the molecular formula C23H20N2
and a molecular weight of 324.43 g/mol. Its IUPAC name is 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole |
| PubChem CID | 5379000 |
| Molecular Formula | C23H20N2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole |
| SMILES | C(=C/c1ccccc1)\C1=NN(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C23H20N2/c1-4-10-19(11-5-1)16-17-21-18-23(20-12-6-2-7-13-20)25(24-21)22-14-8-3-9-15-22/h1-17,23H,18H2/b17-16+ |
| InChIKey | VCDHRDBQAPBSAF-WUKNDPDISA-N |
| XLogP | 5.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole?
The IUPAC name of 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole (CID 5379000) is 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole.
What is the SMILES notation for 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole?
The canonical SMILES for 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole is C(=C/c1ccccc1)\C1=NN(c2ccccc2)C(c2ccccc2)C1.
What is the InChIKey of 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole?
The InChIKey is VCDHRDBQAPBSAF-WUKNDPDISA-N. The full InChI is InChI=1S/C23H20N2/c1-4-10-19(11-5-1)16-17-21-18-23(20-12-6-2-7-13-20)25(24-21)22-14-8-3-9-15-22/h1-17,23H,18H2/b17-16+.
What are the key properties of 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole?
2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole has a molecular weight of 324.43 g/mol, XLogP of 5.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazole is sourced from PubChem (CID 5379000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).