C21H26CuN2O2 — CID 5379739
copper;(6Z)-6-[[7-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]heptylamino]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 5379739) has the molecular formula C21H26CuN2O2 and a molecular weight of 402.00 g/mol. Its IUPAC name is copper;(6Z)-6-[[7-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]heptylamino]methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | copper;(6Z)-6-[[7-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]heptylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 5379739 |
| Molecular Formula | C21H26CuN2O2 |
| Molecular Weight | 402.00 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | copper;(6Z)-6-[[7-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]heptylamino]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C/C1=C/NCCCCCCCN/C=C1/C=CC=CC1=O.[Cu] |
| InChI | InChI=1S/C21H26N2O2.Cu/c24-20-12-6-4-10-18(20)16-22-14-8-2-1-3-9-15-23-17-19-11-5-7-13-21(19)25;/h4-7,10-13,16-17,22-23H,1-3,8-9,14-15H2;/b18-16-,19-17-; |
| InChIKey | BLNZEMOYLXXEGY-BBJOEVDKSA-N |
| XLogP | 3.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.00 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|