C20H24CuN2O3 — CID 5379756
copper;(6Z)-6-[[3-[3-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]propoxy]propylamino]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 5379756) has the molecular formula C20H24CuN2O3 and a molecular weight of 403.97 g/mol. Its IUPAC name is copper;(6Z)-6-[[3-[3-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]propoxy]propylamino]methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | copper;(6Z)-6-[[3-[3-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]propoxy]propylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 5379756 |
| Molecular Formula | C20H24CuN2O3 |
| Molecular Weight | 403.97 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | copper;(6Z)-6-[[3-[3-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]propoxy]propylamino]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C/C1=C/NCCCOCCCN/C=C1/C=CC=CC1=O.[Cu] |
| InChI | InChI=1S/C20H24N2O3.Cu/c23-19-9-3-1-7-17(19)15-21-11-5-13-25-14-6-12-22-16-18-8-2-4-10-20(18)24;/h1-4,7-10,15-16,21-22H,5-6,11-14H2;/b17-15-,18-16-; |
| InChIKey | PNCLNXPGOHHUMD-OWILEKGLSA-N |
| XLogP | 2.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.97 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|