C38H40 — CID 5380034
(2Z,15Z)-2,3,15,16-tetramethylpentacyclo[22.2.2.24,7.211,14.217,20]tetratriaconta-1(27),2,4,6,11,13,15,17(30),18,20(29),24(28),25,31,33-tetradecaene (PubChem CID 5380034) has the molecular formula C38H40 and a molecular weight of 496.74 g/mol. Its IUPAC name is (2Z,15Z)-2,3,15,16-tetramethylpentacyclo[22.2.2.24,7.211,14.217,20]tetratriaconta-1(27),2,4,6,11,13,15,17(30),18,20(29),24(28),25,31,33-tetradecaene.
| Compound Name | (2Z,15Z)-2,3,15,16-tetramethylpentacyclo[22.2.2.24,7.211,14.217,20]tetratriaconta-1(27),2,4,6,11,13,15,17(30),18,20(29),24(28),25,31,33-tetradecaene |
|---|---|
| PubChem CID | 5380034 |
| Molecular Formula | C38H40 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | (2Z,15Z)-2,3,15,16-tetramethylpentacyclo[22.2.2.24,7.211,14.217,20]tetratriaconta-1(27),2,4,6,11,13,15,17(30),18,20(29),24(28),25,31,33-tetradecaene |
| SMILES | C/C1=C(\C)c2ccc(cc2)CCCc2ccc(cc2)/C(C)=C(/C)c2ccc(cc2)CCCc2ccc1cc2 |
| InChI | InChI=1S/C38H40/c1-27-28(2)36-21-13-32(14-22-36)8-6-10-34-17-25-38(26-18-34)30(4)29(3)37-23-15-33(16-24-37)9-5-7-31-11-19-35(27)20-12-31/h11-26H,5-10H2,1-4H3/b28-27-,30-29- |
| InChIKey | FKFNRZKLEXIIEK-HZUKNNFDSA-N |
| XLogP | 10.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|