C32H36N4 — CID 5380079
2,8,12,18-tetraethyl-3,7,13,17-tetramethylporphyrin (PubChem CID 5380079) has the molecular formula C32H36N4 and a molecular weight of 476.67 g/mol. Its IUPAC name is 2,8,12,18-tetraethyl-3,7,13,17-tetramethylporphyrin.
| Compound Name | 2,8,12,18-tetraethyl-3,7,13,17-tetramethylporphyrin |
|---|---|
| PubChem CID | 5380079 |
| Molecular Formula | C32H36N4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2,8,12,18-tetraethyl-3,7,13,17-tetramethylporphyrin |
| SMILES | CCC1=C(C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(CC)=C5C)C(C)=C4CC)C(CC)=C3C |
| InChI | InChI=1S/C32H36N4/c1-9-21-17(5)25-13-26-19(7)23(11-3)31(35-26)16-32-24(12-4)20(8)28(36-32)14-27-18(6)22(10-2)30(34-27)15-29(21)33-25/h13-16H,9-12H2,1-8H3/b25-13-,26-13-,27-14-,28-14-,29-15-,30-15-,31-16-,32-16- |
| InChIKey | VANAHMOSKJFPMT-GDDAKTJHSA-N |
| XLogP | 8.26 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |